5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene
Modify Date: 2026-08-15 13:12:33
5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene structure
|
Common Name | 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene | ||
|---|---|---|---|---|
| CAS Number | 1314045-12-9 | Molecular Weight | 357.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21BrS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21BrS2 |
|---|---|
| Molecular Weight | 357.4 |
| InChIKey | LCDWBXZPEWVLKK-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)Cc1ccc(-c2ccc(Br)s2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene? |
| A: The English name of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene is 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene. |
| Q: What is the Chinese name of 1314045-12-9? |
| A: Chinese name of 1314045-12-9 is 1314045-12-9. |
| Q: What is the SMILES notation of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene? |
| A: SMILES notation of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene is CCCCC(CC)Cc1ccc(-c2ccc(Br)s2)s1. |
| Q: What is the CAS number of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene? |
| A: CAS number of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene is 1314045-12-9. |
| Q: What is the molecular weight of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene? |
| A: Molecular weight of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene is 357.4. |
| Q: What is the InChIKey of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene? |
| A: InChIKey of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene is LCDWBXZPEWVLKK-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene? |
| A: Molecular formula of 5-Bromo-5'-(2-ethylhexyl)-2,2'-bithiophene is C16H21BrS2. |