Urea,N-(4-chloro-2-methylphenyl)-N'-phenyl- structure
|
Common Name | Urea,N-(4-chloro-2-methylphenyl)-N'-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 13142-67-1 | Molecular Weight | 260.71900 | |
| Density | 1.316g/cm3 | Boiling Point | 305.6ºC at 760mmHg | |
| Molecular Formula | C14H13ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.6ºC | |
| Name | 1-(4-chloro-2-methylphenyl)-3-phenylurea |
|---|
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 305.6ºC at 760mmHg |
| Molecular Formula | C14H13ClN2O |
| Molecular Weight | 260.71900 |
| Flash Point | 138.6ºC |
| Exact Mass | 260.07200 |
| PSA | 41.13000 |
| LogP | 4.43840 |
| Vapour Pressure | 0.000814mmHg at 25°C |
| Index of Refraction | 1.679 |
| InChIKey | LORSVVSKTARGKE-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)ccc1NC(=O)Nc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |