Lipoamido-PEG4-acid structure
|
Common Name | Lipoamido-PEG4-acid | ||
|---|---|---|---|---|
| CAS Number | 1314378-10-3 | Molecular Weight | 453.614 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 650.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C19H35NO7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 347.3±31.5 °C | |
Use of Lipoamido-PEG4-acidLipoamido-PEG4-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Lipoamido-PEG4-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Lipoamido-PEG4-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 650.7±55.0 °C at 760 mmHg |
| Molecular Formula | C19H35NO7S2 |
| Molecular Weight | 453.614 |
| Flash Point | 347.3±31.5 °C |
| Exact Mass | 453.185486 |
| LogP | 0.28 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | QJFPDZROPSGMGV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCNC(=O)CCCCC1CCSS1 |
| LIPOAMIDO-PEG4-COOH |