2H-Thiazolo[3,2-a]-1,3,5-triazine-2,4(3H)-dione,tetrahydro-8a-(1-methylethyl)- structure
|
Common Name | 2H-Thiazolo[3,2-a]-1,3,5-triazine-2,4(3H)-dione,tetrahydro-8a-(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 13146-74-2 | Molecular Weight | 215.27300 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H13N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8a-propan-2-yl-6,7-dihydro-1H-[1,3]thiazolo[3,2-a][1,3,5]triazine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.27300 |
| Exact Mass | 215.07300 |
| PSA | 86.74000 |
| LogP | 1.37330 |
| Index of Refraction | 1.619 |
| InChIKey | RMGGTTVWKXYCLW-UHFFFAOYSA-N |
| SMILES | CC(C)C12NC(=O)NC(=O)N1CCS2 |
| HS Code | 2934100090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 8a-Isopropyl-5,7-dioxo-2,3,5,6,7,8,8a-heptahydro-thiazolo<3,2-a>-s-triazin |
| 8a-isopropyl-tetrahydro-thiazolo[3,2-a][1,3,5]triazine-2,4-dione |
| 8a-Isopropyltetrahydro-2H-(1,3)thiazolo(3,2-a)(1,3,5)triazine-2,4(3H)-dione |
| 8a-(propan-2-yl)tetrahydro-2h-[1,3]thiazolo[3,2-a][1,3,5]triazine-2,4(3h)-dione |