2,4-Dichloro-6-(4-Fluorophenylamino)-1,3,5-Triazine structure
|
Common Name | 2,4-Dichloro-6-(4-Fluorophenylamino)-1,3,5-Triazine | ||
|---|---|---|---|---|
| CAS Number | 131468-33-2 | Molecular Weight | 259.06700 | |
| Density | 1.586g/cm3 | Boiling Point | 437.8ºC at 760mmHg | |
| Molecular Formula | C9H5Cl2FN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.6ºC | |
| Name | 4,6-dichloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.586g/cm3 |
|---|---|
| Boiling Point | 437.8ºC at 760mmHg |
| Molecular Formula | C9H5Cl2FN4 |
| Molecular Weight | 259.06700 |
| Flash Point | 218.6ºC |
| Exact Mass | 257.98800 |
| PSA | 50.70000 |
| LogP | 3.13410 |
| Vapour Pressure | 7.27E-08mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | GVFNRSSFMJILLU-UHFFFAOYSA-N |
| SMILES | Fc1ccc(Nc2nc(Cl)nc(Cl)n2)cc1 |
| HS Code | 2933699090 |
|---|
|
~33%
2,4-Dichloro-6-... CAS#:131468-33-2 |
| Literature: WO2011/39735 A2, ; Page/Page column 154 ; WO 2011/039735 A2 |
|
~80%
2,4-Dichloro-6-... CAS#:131468-33-2 |
| Literature: Khatri, Vineeta; Sareen, Vineeta; Garg, Urmila; Taneja, Poonam; Sharma, Kanti Journal of the Indian Chemical Society, 2003 , vol. 80, # 1 p. 53 - 54 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 2,4-Dichloro-6-(4-fluorophenylamino)-1,3,5-triazine |
| 2,6-dichloro-N-(4-fluorophenyl)-1,3,5-triazin-2-amine |
| 2,4-dichloro-6-(4-fluoroanilino)-1,3,5-triazine |
| MFCD00115403 |
| 2-(2-METHYL-3-OXO-2,3-DIHYDRO-4H-1,4-BENZOXAZIN-4-YL)BUTANOIC ACID |
| (4,6-dichloro(1,3,5-triazin-2-yl))(4-fluorophenyl)amine |
| 2,4-dichloro-4-fluorophenylamino-1,3,5-triazine |