2,2-dichloroacenaphthen-1-one structure
|
Common Name | 2,2-dichloroacenaphthen-1-one | ||
|---|---|---|---|---|
| CAS Number | 13152-85-7 | Molecular Weight | 237.08100 | |
| Density | 1.49g/cm3 | Boiling Point | 362.7ºC at 760 mmHg | |
| Molecular Formula | C12H6Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.3ºC | |
| Name | 2,2-dichloroacenaphthylen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 362.7ºC at 760 mmHg |
| Molecular Formula | C12H6Cl2O |
| Molecular Weight | 237.08100 |
| Flash Point | 153.3ºC |
| Exact Mass | 235.98000 |
| PSA | 17.07000 |
| LogP | 3.66650 |
| Vapour Pressure | 1.89E-05mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | MAUALHPVHNLDNX-UHFFFAOYSA-N |
| SMILES | O=C1c2cccc3cccc(c23)C1(Cl)Cl |
|
~%
2,2-dichloroace... CAS#:13152-85-7 |
| Literature: Morgan; Stanley Journal of the Society of Chemical Industry, London, 1925 , vol. 44, p. 494 T Chem. Zentralbl., 1926 , vol. 97, # I p. 927 |
|
~%
2,2-dichloroace... CAS#:13152-85-7 |
| Literature: Graebe; Jequier Justus Liebigs Annalen der Chemie, 1896 , vol. 290, p. 200 |
| 2,2-dichloro-acenaphthen-1-one |
| 2,2-Dichlor-acenaphthenon |
| 2.2-Dichlor-1-oxo-acenaphthen |
| 2,2-Dichlor-acenaphthen-1-on |