2-Acetoxy-5-acetoxymethyl-1,3-di-tert-butylbenzene structure
|
Common Name | 2-Acetoxy-5-acetoxymethyl-1,3-di-tert-butylbenzene | ||
|---|---|---|---|---|
| CAS Number | 13154-59-1 | Molecular Weight | 320.42300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-acetyloxy-3,5-ditert-butylphenyl)methyl acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H28O4 |
|---|---|
| Molecular Weight | 320.42300 |
| Exact Mass | 320.19900 |
| PSA | 52.60000 |
| LogP | 4.27000 |
| InChIKey | AGSCDHUVCJYCSX-UHFFFAOYSA-N |
| SMILES | CC(=O)OCc1cc(C(C)(C)C)c(OC(C)=O)c(C(C)(C)C)c1 |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 2-Acetoxy-5-acetoxymethyl-1,3-di-tert-butylbenzene |