Phenol,2-[[(4-nitrophenyl)amino]methyl]- structure
|
Common Name | Phenol,2-[[(4-nitrophenyl)amino]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 13159-73-4 | Molecular Weight | 244.24600 | |
| Density | 1.357g/cm3 | Boiling Point | 444.3ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.5ºC | |
| Name | 2-[(4-nitroanilino)methyl]phenol |
|---|
| Density | 1.357g/cm3 |
|---|---|
| Boiling Point | 444.3ºC at 760 mmHg |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.24600 |
| Flash Point | 222.5ºC |
| Exact Mass | 244.08500 |
| PSA | 78.08000 |
| LogP | 3.50870 |
| Vapour Pressure | 1.65E-08mmHg at 25°C |
| Index of Refraction | 1.69 |
| InChIKey | XXFBEWGVOTUXHP-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccccc2O)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |