4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid structure
|
Common Name | 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 13159-79-0 | Molecular Weight | 277.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H12ClNO3 |
|---|---|
| Molecular Weight | 277.70 |
| InChIKey | FOCXOBBFCYPUSV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NCc2ccc(Cl)cc2)cc1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 13159-79-0? |
| A: Chinese name of 13159-79-0 is 13159-79-0. |
| Q: What is the SMILES notation of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid? |
| A: SMILES notation of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid is O=C(O)c1ccc(NCc2ccc(Cl)cc2)cc1O. |
| Q: What is the InChIKey of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid? |
| A: InChIKey of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid is FOCXOBBFCYPUSV-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid? |
| A: CAS number of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid is 13159-79-0. |
| Q: What is the English name of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid? |
| A: The English name of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid is 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid. |
| Q: What is the molecular formula of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid? |
| A: Molecular formula of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid is C14H12ClNO3. |
| Q: What is the molecular weight of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid? |
| A: Molecular weight of 4-{[(4-Chlorophenyl)methyl]amino}-2-hydroxybenzoic acid is 277.70. |