(4-chloro-benzyl)-pyridin-4-yl-amine dihydrochloride structure
|
Common Name | (4-chloro-benzyl)-pyridin-4-yl-amine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 13159-80-3 | Molecular Weight | 291.60400 | |
| Density | 1.251g/cm3 | Boiling Point | 360.4ºC at 760mmHg | |
| Molecular Formula | C12H13Cl3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.8ºC | |
| Name | (4-chloro-benzyl)-pyridin-4-yl-amine dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 360.4ºC at 760mmHg |
| Molecular Formula | C12H13Cl3N2 |
| Molecular Weight | 291.60400 |
| Flash Point | 171.8ºC |
| Exact Mass | 290.01400 |
| PSA | 24.92000 |
| LogP | 5.02410 |
| Vapour Pressure | 2.22E-05mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | BFSAOPHXPQNMKL-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Clc1ccc(CNc2ccncc2)cc1 |
| HS Code | 2933399090 |
|---|
|
~%
(4-chloro-benzy... CAS#:13159-80-3 |
| Literature: Kato; Hagiwara Yakugaku Zasshi, 1953 , vol. 73, p. 145,146,147 Chem.Abstr., 1953 , p. 11 192 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Einecs 236-098-9 |