4-Chloro-N-(3-nitrophenyl)benzenemethanamine
Modify Date: 2025-11-07 17:03:26
4-Chloro-N-(3-nitrophenyl)benzenemethanamine structure
|
Common Name | 4-Chloro-N-(3-nitrophenyl)benzenemethanamine | ||
|---|---|---|---|---|
| CAS Number | 13159-84-7 | Molecular Weight | 262.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Chloro-N-(3-nitrophenyl)benzenemethanamine |
|---|
| Molecular Formula | C13H11ClN2O2 |
|---|---|
| Molecular Weight | 262.69 |
| InChIKey | LQOYLPSTYSVVDG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(NCc2ccc(Cl)cc2)c1 |
|
Name: Inhibition of urease in Helicobacter pylori ATCC 43504 assessed as ammonia production...
Source: ChEMBL
Target: Urease subunit beta
External Id: CHEMBL3595645
|
|
Name: Inhibition of urease isolated from Helicobacter pylori ATCC 43504 assessed as ammonia...
Source: ChEMBL
Target: Urease subunit beta
External Id: CHEMBL3595644
|
Total 2, Current Page 1 of 1
1