3-chloro-N-(3-chloro-4-fluorophenyl)propanamide structure
|
Common Name | 3-chloro-N-(3-chloro-4-fluorophenyl)propanamide | ||
|---|---|---|---|---|
| CAS Number | 131605-66-8 | Molecular Weight | 236.07000 | |
| Density | 1.417g/cm3 | Boiling Point | 383ºC at 760 mmHg | |
| Molecular Formula | C9H8Cl2FNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.4ºC | |
| Name | 3-chloro-N-(3-chloro-4-fluorophenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 383ºC at 760 mmHg |
| Molecular Formula | C9H8Cl2FNO |
| Molecular Weight | 236.07000 |
| Flash Point | 185.4ºC |
| Exact Mass | 234.99700 |
| PSA | 29.10000 |
| LogP | 3.11950 |
| Vapour Pressure | 4.55E-06mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | VJQJGNHCAHOAMD-UHFFFAOYSA-N |
| SMILES | O=C(CCCl)Nc1ccc(F)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3'-chloro-4'-fluoro-3-chloropropionanilide |