1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate
Modify Date: 2025-08-26 15:41:55
1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate structure
|
Common Name | 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1316632-45-7 | Molecular Weight | 331.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H17NO3 |
|---|---|
| Molecular Weight | 331.4 |
| InChIKey | BSKOPASZEVQNPW-UHFFFAOYSA-N |
| SMILES | CC(OC(=O)C1=Cc2ccccc2OC1)c1cnc2ccccc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate? |
| A: SMILES notation of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate is CC(OC(=O)C1=Cc2ccccc2OC1)c1cnc2ccccc2c1. |
| Q: What is the Chinese name of 1316632-45-7? |
| A: Chinese name of 1316632-45-7 is 1316632-45-7. |
| Q: What is the English name of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate? |
| A: The English name of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate is 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate. |
| Q: What is the CAS number of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate? |
| A: CAS number of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate is 1316632-45-7. |
| Q: What is the molecular formula of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate? |
| A: Molecular formula of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate is C21H17NO3. |
| Q: What is the molecular weight of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate? |
| A: Molecular weight of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate is 331.4. |
| Q: What is the InChIKey of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate? |
| A: InChIKey of 1-(Quinolin-3-yl)ethyl 2H-chromene-3-carboxylate is BSKOPASZEVQNPW-UHFFFAOYSA-N. |