NAP-1 structure
|
Common Name | NAP-1 | ||
|---|---|---|---|---|
| CAS Number | 131721-28-3 | Molecular Weight | 339.815 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 481.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.8±28.7 °C | |
Use of NAP-1NAP-1 is a compound with anesthetic activity. It increases paired-pulse inhibition in the CA1 region of the hippocampus. |
| Name | NAP-1 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 481.1±45.0 °C at 760 mmHg |
| Molecular Formula | C20H18ClNO2 |
| Molecular Weight | 339.815 |
| Flash Point | 244.8±28.7 °C |
| Exact Mass | 339.102600 |
| LogP | 6.53 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | RYNBQQWODYCGRR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(-c2ccc(Cl)cc2)n(-c2ccccc2)c1C |
| 1H-Pyrrole-3-carboxylic acid, 5-(4-chlorophenyl)-2-methyl-1-phenyl-, ethyl ester |
| Ethyl 5-(4-chlorophenyl)-2-methyl-1-phenyl-1H-pyrrole-3-carboxylate |
| NAP-1 |