2-(2-bromoethyl)-2H-naphtho[1,8-cd]isothiazole 1,1-dioxide structure
|
Common Name | 2-(2-bromoethyl)-2H-naphtho[1,8-cd]isothiazole 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 131729-17-4 | Molecular Weight | 312.182 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 488.7±47.0 °C at 760 mmHg | |
| Molecular Formula | C12H10BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.4±29.3 °C | |
| Name | 2-(2-bromoethyl)-2H-naphtho[1,8-cd]isothiazole 1,1-dioxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.7±47.0 °C at 760 mmHg |
| Molecular Formula | C12H10BrNO2S |
| Molecular Weight | 312.182 |
| Flash Point | 249.4±29.3 °C |
| Exact Mass | 310.961548 |
| PSA | 45.76000 |
| LogP | 2.26 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.714 |
| InChIKey | RFBNGWPBQUOUNT-UHFFFAOYSA-N |
| SMILES | O=S1(=O)c2cccc3cccc(c23)N1CCBr |
| HS Code | 2934991000 |
|---|
| HS Code | 2934991000 |
|---|---|
| Summary | 2934991000. sultones and sultams. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2H-Naphth[1,8-cd]isothiazole, 2-(2-bromoethyl)-, 1,1-dioxide |
| 2-(2-bromoethyl)-2H-naphtho[1,8-cd]isothiazole 1,1-dioxide |
| 2-(2-Bromoethyl)-2H-naphtho[1,8-cd][1,2]thiazole 1,1-dioxide |