Simendan structure
|
Common Name | Simendan | ||
|---|---|---|---|---|
| CAS Number | 131741-08-7 | Molecular Weight | 280.285 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H12N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Simendan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C14H12N6O |
| Molecular Weight | 280.285 |
| Exact Mass | 280.107269 |
| PSA | 113.43000 |
| LogP | 0.59 |
| Index of Refraction | 1.673 |
| InChIKey | WHXMKTBCFHIYNQ-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)NN=C1c1ccc(NN=C(C#N)C#N)cc1 |
| HS Code | 2933990090 |
|---|
|
~95%
Simendan CAS#:131741-08-7 |
| Literature: Orion-yhtyma Oy Patent: US5424428 A1, 1995 ; |
|
~%
Simendan CAS#:131741-08-7 |
| Literature: US5019575 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Mesoxalonitrile (±)-(p-(1,4,5,6-Tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl)hydrazone |
| Propanedinitrile, 2-[2-[4-(1,4,5,6-tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl]hydrazinylidene]- |
| (±)-((4-(1,4,5,6-Tetrahydro-4-methyl-6-oxo-3-pyridazinyl)phenyl)hydrazono)propanedinitrile |
| LEVOFLUOROCARBOXYLICACID |
| {2-[4-(4-methyl-6-oxo-1,4,5,6-tetrahydropyridazin-3-yl)phenyl]hydrazinylidene}propanedinitrile |
| MFCD00867135 |
| {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydro-3-pyridazinyl)phenyl]hydrazono}malononitrile |
| levosimendan |
| {[4-(4-Methyl-6-oxo-1,4,5,6-tetrahydropyridazin-3-yl)phenyl]hydrazono}malononitrile |