methyl (E)-2-[2-[6-(2-carbamoylphenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate structure
|
Common Name | methyl (E)-2-[2-[6-(2-carbamoylphenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 131860-82-7 | Molecular Weight | 421.403 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 619.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C22H19N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.6±31.5 °C | |
| Name | methyl (E)-2-[2-[6-(2-carbamoylphenoxy)pyrimidin-4-yl]oxyphenyl]-3-methoxyprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 619.7±55.0 °C at 760 mmHg |
| Molecular Formula | C22H19N3O6 |
| Molecular Weight | 421.403 |
| Flash Point | 328.6±31.5 °C |
| Exact Mass | 421.127380 |
| PSA | 123.85000 |
| LogP | 3.73 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | CEKITTBOYGDAQZ-FOWTUZBSSA-N |
| SMILES | COC=C(C(=O)OC)c1ccccc1Oc1cc(Oc2ccccc2C(N)=O)ncn1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzeneacetic acid,2-[[6-[2-(aminocarbonyl)phenoxy]-4-pyrimidinyl]oxy]-|A-(methoxymethylene)-,methyl ester,(E) |
| (E)-Methyl 2-(2-((6-(2-carbamoylphenoxy)pyrimidin-4-yl)oxy)phenyl)-3-methoxyacrylate |
| BEN387 |
| Benzeneacetic acid, 2-[[6-[2-(aminocarbonyl)phenoxy]-4-pyrimidinyl]oxy]-α-(methoxymethylene)-, methyl ester, (αE)- |
| Methyl (2E)-2-(2-{[6-(2-carbamoylphenoxy)-4-pyrimidinyl]oxy}phenyl)-3-methoxyacrylate |