Thiophene, 2-(2-nitro-1-propenyl)-, (Z)
Modify Date: 2026-03-28 11:58:00
Thiophene, 2-(2-nitro-1-propenyl)-, (Z) structure
|
Common Name | Thiophene, 2-(2-nitro-1-propenyl)-, (Z) | ||
|---|---|---|---|---|
| CAS Number | 131981-74-3 | Molecular Weight | 169.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Thiophene, 2-(2-nitro-1-propenyl)-, (Z) |
|---|
| Molecular Formula | C7H7NO2S |
|---|---|
| Molecular Weight | 169.2 |
| InChIKey | HMPLFCAOIJOKGX-WAYWQWQTSA-N |
| SMILES | C/C(=C/C1=CC=CS1)/[N+](=O)[O-] |
|
Name: Antioxidant activity assessed as trolox equivalent of AAPH-induced peroxyl radical sc...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4264721
|
Total 1, Current Page 1 of 1
1