Thiophene, 2-(2-nitro-1-propenyl)-, (Z)
Modify Date: 2026-03-28 11:58:00
Thiophene, 2-(2-nitro-1-propenyl)-, (Z) structure
|
Common Name | Thiophene, 2-(2-nitro-1-propenyl)-, (Z) | ||
|---|---|---|---|---|
| CAS Number | 131981-74-3 | Molecular Weight | 169.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Thiophene, 2-(2-nitro-1-propenyl)-, (Z) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H7NO2S |
|---|---|
| Molecular Weight | 169.2 |
| InChIKey | HMPLFCAOIJOKGX-WAYWQWQTSA-N |
| SMILES | C/C(=C/C1=CC=CS1)/[N+](=O)[O-] |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antioxidant activity assessed as trolox equivalent of AAPH-induced peroxyl radical sc...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4264721
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Thiophene, 2-(2-nitro-1-propenyl)-, (Z)? |
| A: InChIKey of Thiophene, 2-(2-nitro-1-propenyl)-, (Z) is HMPLFCAOIJOKGX-WAYWQWQTSA-N. |
| Q: What is the SMILES notation of Thiophene, 2-(2-nitro-1-propenyl)-, (Z)? |
| A: SMILES notation of Thiophene, 2-(2-nitro-1-propenyl)-, (Z) is C/C(=C/C1=CC=CS1)/[N+](=O)[O-]. |
| Q: What is the Chinese name of 131981-74-3? |
| A: Chinese name of 131981-74-3 is 131981-74-3. |
| Q: What is the CAS number of Thiophene, 2-(2-nitro-1-propenyl)-, (Z)? |
| A: CAS number of Thiophene, 2-(2-nitro-1-propenyl)-, (Z) is 131981-74-3. |
| Q: What is the molecular formula of Thiophene, 2-(2-nitro-1-propenyl)-, (Z)? |
| A: Molecular formula of Thiophene, 2-(2-nitro-1-propenyl)-, (Z) is C7H7NO2S. |
| Q: What is the English name of Thiophene, 2-(2-nitro-1-propenyl)-, (Z)? |
| A: The English name of Thiophene, 2-(2-nitro-1-propenyl)-, (Z) is Thiophene, 2-(2-nitro-1-propenyl)-, (Z). |
| Q: What is the molecular weight of Thiophene, 2-(2-nitro-1-propenyl)-, (Z)? |
| A: Molecular weight of Thiophene, 2-(2-nitro-1-propenyl)-, (Z) is 169.2. |