N,N'-Bis(2,5-dichlorophenyl)urea structure
|
Common Name | N,N'-Bis(2,5-dichlorophenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 13201-85-9 | Molecular Weight | 350.02700 | |
| Density | 1.608g/cm3 | Boiling Point | 355.3ºC at 760 mmHg | |
| Molecular Formula | C13H8Cl4N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.7ºC | |
| Name | 1,3-bis(2,5-dichlorophenyl)urea |
|---|
| Density | 1.608g/cm3 |
|---|---|
| Boiling Point | 355.3ºC at 760 mmHg |
| Molecular Formula | C13H8Cl4N2O |
| Molecular Weight | 350.02700 |
| Flash Point | 168.7ºC |
| Exact Mass | 347.93900 |
| PSA | 44.62000 |
| LogP | 6.03080 |
| Vapour Pressure | 3.16E-05mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | NGADHVHLPNQITE-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)Nc1cc(Cl)ccc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |