Pyrimidine,2-ethoxy-5-nitro structure
|
Common Name | Pyrimidine,2-ethoxy-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 13207-98-2 | Molecular Weight | 169.13800 | |
| Density | 1.319g/cm3 | Boiling Point | 310.3ºC at 760mmHg | |
| Molecular Formula | C6H7N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethoxy-5-nitropyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 310.3ºC at 760mmHg |
| Molecular Formula | C6H7N3O3 |
| Molecular Weight | 169.13800 |
| Exact Mass | 169.04900 |
| PSA | 80.83000 |
| LogP | 1.30670 |
| Vapour Pressure | 0.00111mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | RXXOFJDSHUEKPM-UHFFFAOYSA-N |
| SMILES | CCOc1ncc([N+](=O)[O-])cn1 |
| HS Code | 2933599090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Aethoxy-5-nitro-pyrimidin |
| 2-ethoxy-5-nitro-pyrimidine |