Carbanilide, 2,2-dichloro- structure
|
Common Name | Carbanilide, 2,2-dichloro- | ||
|---|---|---|---|---|
| CAS Number | 13208-19-0 | Molecular Weight | 281.13700 | |
| Density | 1.45g/cm3 | Boiling Point | 310.8ºC at 760 mmHg | |
| Molecular Formula | C13H10Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.8ºC | |
| Name | 1,3-Bis(o-chlorophenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45g/cm3 |
|---|---|
| Boiling Point | 310.8ºC at 760 mmHg |
| Molecular Formula | C13H10Cl2N2O |
| Molecular Weight | 281.13700 |
| Flash Point | 141.8ºC |
| Exact Mass | 280.01700 |
| PSA | 41.13000 |
| LogP | 4.78340 |
| Vapour Pressure | 0.000587mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | FUXMTFVWDZUSSG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1Cl)Nc1ccccc1Cl |
| HS Code | 2924299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Bis(2-chlorophenyl)urea |
| N,N'-bis(o-chlorophenyl)urea |
| N,N'-bis(2-chlorophenyl)urea |
| 1,3-di-o-chlorophenylcarbamide |
| N,N'-Bis-(2-chlor-phenyl)-harnstoff |