3-(4-fluorophenyl)-1-(2-methylphenyl)urea
Modify Date: 2025-11-26 12:24:48
3-(4-fluorophenyl)-1-(2-methylphenyl)urea structure
|
Common Name | 3-(4-fluorophenyl)-1-(2-methylphenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 13208-38-3 | Molecular Weight | 244.26400 | |
| Density | 1.283g/cm3 | Boiling Point | 275ºC at 760 mmHg | |
| Molecular Formula | C14H13FN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.1ºC | |
| Name | 1-(4-fluorophenyl)-3-(2-methylphenyl)urea |
|---|
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 275ºC at 760 mmHg |
| Molecular Formula | C14H13FN2O |
| Molecular Weight | 244.26400 |
| Flash Point | 120.1ºC |
| Exact Mass | 244.10100 |
| PSA | 41.13000 |
| LogP | 3.92410 |
| Vapour Pressure | 0.00522mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | FJXYZNCWLFXRAY-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1NC(=O)Nc1ccc(F)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |