6-(4-Methyl-1-piperazinyl)-3-pyridinecarboxylic acid methyl ester structure
|
Common Name | 6-(4-Methyl-1-piperazinyl)-3-pyridinecarboxylic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 132144-02-6 | Molecular Weight | 235.28200 | |
| Density | 1.154g/cm3 | Boiling Point | 371.518ºC at 760 mmHg | |
| Molecular Formula | C12H17N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.488ºC | |
| Name | Methyl 6-(4-methylpiperazin-1-yl)pyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.154g/cm3 |
|---|---|
| Boiling Point | 371.518ºC at 760 mmHg |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.28200 |
| Flash Point | 178.488ºC |
| Exact Mass | 235.13200 |
| PSA | 45.67000 |
| LogP | 0.62290 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | UQVXHYAVALLCBQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(N2CCN(C)CC2)nc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 6-(4-methyl-1-piperazinyl)nicotinate |
| 6-(4-methyl-piperazin-1-yl)-nicotinic acid methyl ester |
| Methyl 6-(4-methylpiperazin-1-yl)nicotinate |
| methyl 6-(4-methyl-1-piperazinyl)pyridine-3-carboxylate |
| 6-(4-METHYL-(PIPERAZIN-1-YL))-3-PYRIDINECARBOXYLIC ACID METHYL ESTER |