calcium undecylenate structure
|
Common Name | calcium undecylenate | ||
|---|---|---|---|---|
| CAS Number | 1322-14-1 | Molecular Weight | 406.61300 | |
| Density | N/A | Boiling Point | 300.8ºC at 760 mmHg | |
| Molecular Formula | C22H38CaO4 | Melting Point | 146ºC | |
| MSDS | N/A | Flash Point | 145.8ºC | |
| Name | calcium,undec-10-enoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 300.8ºC at 760 mmHg |
|---|---|
| Melting Point | 146ºC |
| Molecular Formula | C22H38CaO4 |
| Molecular Weight | 406.61300 |
| Flash Point | 145.8ºC |
| Exact Mass | 406.24000 |
| PSA | 52.60000 |
| LogP | 6.60140 |
| Vapour Pressure | 0.000257mmHg at 25°C |
| InChIKey | CLOKKBBIKHZGNX-UHFFFAOYSA-L |
| SMILES | C=CCCCCCCCCC(=O)[O-].C=CCCCCCCCCC(=O)[O-].[Ca+2] |
| HS Code | 2916190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Calcium undecylenate (USP) |
| Undec-10-ensaeure,Calciumsalz |
| 10-Undecenoic acid calcium salt |
| Calcium undecylenate |
| Calcium diundec-10-enoate |
| undec-10-enoic acid,calcium salt |
| calcium undec-10-enoate |
| UNII-77YW1RTU8V |
| Cal-Desene |