2,3-Pentadiene, 1,1,1,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)- structure
|
Common Name | 2,3-Pentadiene, 1,1,1,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 13222-45-2 | Molecular Weight | 312.05600 | |
| Density | 1.548g/cm3 | Boiling Point | 181.3ºC at 760mmHg | |
| Molecular Formula | C7F12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 53.1ºC | |
| Name | 1,1,1,5,5,5-hexafluoro-2,4-bis(trifluoromethyl)penta-2,3-diene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.548g/cm3 |
|---|---|
| Boiling Point | 181.3ºC at 760mmHg |
| Molecular Formula | C7F12 |
| Molecular Weight | 312.05600 |
| Flash Point | 53.1ºC |
| Exact Mass | 311.98100 |
| LogP | 4.68730 |
| Vapour Pressure | 1.16mmHg at 25°C |
| Index of Refraction | 1.285 |
| InChIKey | NDOOQHLJBXHLCE-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(=C=C(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| HS Code | 2903399090 |
|---|
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| tetrakistrifluoromethylallene |
| Tetrakis-<trifluormethyl>-allen |
| 1,1,1,5,5,5-hexafluoro-2,4-bis-trifluoromethyl-penta-2,3-diene |