Tiamulin-d10 hydrochloride structure
|
Common Name | Tiamulin-d10 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1322626-74-3 | Molecular Weight | 540.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H38D10ClNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tiamulin-d10 hydrochlorideTiamulin-d10 (Thiamutilin-d10) hydrochloride is the deuterium labeled Tiamulin. Tiamulin (Thiamutilin) is a diterpenic compound that widely used in swine for the control of infectious diseases, including swine dysentery and enzootic pneumonia[1][2][3]. |
| Name | Tiamulin-d10 hydrochloride |
|---|
| Description | Tiamulin-d10 (Thiamutilin-d10) hydrochloride is the deuterium labeled Tiamulin. Tiamulin (Thiamutilin) is a diterpenic compound that widely used in swine for the control of infectious diseases, including swine dysentery and enzootic pneumonia[1][2][3]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C28H38D10ClNO4S |
|---|---|
| Molecular Weight | 540.26 |
| InChIKey | WRHXJTYYMRJQPZ-YUQTXXDYSA-N |
| SMILES | C=CC1(C)CC(OC(=O)CSCCN(CC)CC)C2(C)C(C)CCC3(CCC(=O)C32)C(C)C1O.Cl |