4-Amino-5-p-tolyl-4H-[1,2,4]triazole-3-thiol structure
|
Common Name | 4-Amino-5-p-tolyl-4H-[1,2,4]triazole-3-thiol | ||
|---|---|---|---|---|
| CAS Number | 13229-01-1 | Molecular Weight | 206.26700 | |
| Density | 1.42g/cm3 | Boiling Point | 321.3ºC at 760mmHg | |
| Molecular Formula | C9H10N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.1ºC | |
| Name | 4-amino-3-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 321.3ºC at 760mmHg |
| Molecular Formula | C9H10N4S |
| Molecular Weight | 206.26700 |
| Flash Point | 148.1ºC |
| Exact Mass | 206.06300 |
| PSA | 95.53000 |
| LogP | 1.83720 |
| Vapour Pressure | 0.0003mmHg at 25°C |
| Index of Refraction | 1.731 |
| InChIKey | MXONMXJEHNDQPJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2N)cc1 |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Amino-5-(4-methylphenyl)-4H-1,2,4-triazole-3-thiol |
| 4-amino-3-mercapto-5-(4-methylphenyl)-1,2,4-triazole |
| 3-p-methylphenyl-4-amino-5-mercapto-1,2,4-triazole |
| 4-amino-5-(4-methylphenyl)-1,2,4-triazole-3-thiol |
| 3-(p-methylphenyl)-4-amino-5-mercapto-4H-1,2,4-triazole |
| 3-(4-methylphenyl)-4-amino-5-mercapto-1,2,4-triazole |
| 4-amino-5-p-tolyl-2,4-dihydro-[1,2,4]triazole-3-thione |