Bis((2-hydroxyethyl)trimethylazanium) sulfate
Modify Date: 2026-09-28 14:01:50
Bis((2-hydroxyethyl)trimethylazanium) sulfate structure
|
Common Name | Bis((2-hydroxyethyl)trimethylazanium) sulfate | ||
|---|---|---|---|---|
| CAS Number | 13232-47-8 | Molecular Weight | 304.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H28N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bis((2-hydroxyethyl)trimethylazanium) sulfate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H28N2O6S |
|---|---|
| Molecular Weight | 304.41 |
| InChIKey | SUJMSBLYCLWFHB-UHFFFAOYSA-L |
| SMILES | C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=S(=O)([O-])[O-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Bis((2-hydroxyethyl)trimethylazanium) sulfate? |
| A: SMILES notation of Bis((2-hydroxyethyl)trimethylazanium) sulfate is C[N+](C)(C)CCO.C[N+](C)(C)CCO.O=S(=O)([O-])[O-]. |
| Q: What is the CAS number of Bis((2-hydroxyethyl)trimethylazanium) sulfate? |
| A: CAS number of Bis((2-hydroxyethyl)trimethylazanium) sulfate is 13232-47-8. |
| Q: What is the molecular weight of Bis((2-hydroxyethyl)trimethylazanium) sulfate? |
| A: Molecular weight of Bis((2-hydroxyethyl)trimethylazanium) sulfate is 304.41. |
| Q: What is the InChIKey of Bis((2-hydroxyethyl)trimethylazanium) sulfate? |
| A: InChIKey of Bis((2-hydroxyethyl)trimethylazanium) sulfate is SUJMSBLYCLWFHB-UHFFFAOYSA-L. |
| Q: What is the Chinese name of 13232-47-8? |
| A: Chinese name of 13232-47-8 is 13232-47-8. |
| Q: What is the molecular formula of Bis((2-hydroxyethyl)trimethylazanium) sulfate? |
| A: Molecular formula of Bis((2-hydroxyethyl)trimethylazanium) sulfate is C10H28N2O6S. |
| Q: What is the English name of Bis((2-hydroxyethyl)trimethylazanium) sulfate? |
| A: The English name of Bis((2-hydroxyethyl)trimethylazanium) sulfate is Bis((2-hydroxyethyl)trimethylazanium) sulfate. |