Hexanitrobenzene
Modify Date: 2026-07-05 15:53:29
Hexanitrobenzene structure
|
Common Name | Hexanitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 13232-74-1 | Molecular Weight | 348.09700 | |
| Density | 2.169g/cm3 | Boiling Point | 591.541ºC at 760 mmHg | |
| Molecular Formula | C6N6O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 316.093ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Hexanitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 2.169g/cm3 |
|---|---|
| Boiling Point | 591.541ºC at 760 mmHg |
| Molecular Formula | C6N6O12 |
| Molecular Weight | 348.09700 |
| Flash Point | 316.093ºC |
| Exact Mass | 347.95700 |
| PSA | 274.92000 |
| LogP | 4.27500 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.752 |
| InChIKey | BVKZIAODKDJPLW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Hexanitrobenzol |
| ETHANE,HEXANITRO |
| Hexanitroethan |
| Hexanitroethane |
| Hexanitroaethan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of Hexanitrobenzene? |
| A: Boiling point of Hexanitrobenzene is 591.541ºC at 760 mmHg. |
| Q: What English synonyms does Hexanitrobenzene have? |
| A: English synonyms of Hexanitrobenzene: Hexanitrobenzol, ETHANE,HEXANITRO, Hexanitroethan, Hexanitroethane, Hexanitroaethan. |
| Q: What is the CAS number of Hexanitrobenzene? |
| A: CAS number of Hexanitrobenzene is 13232-74-1. |
| Q: What is the English name of Hexanitrobenzene? |
| A: The English name of Hexanitrobenzene is Hexanitrobenzene. |
| Q: What is the SMILES notation of Hexanitrobenzene? |
| A: SMILES notation of Hexanitrobenzene is O=[N+]([O-])c1c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-]. |
| Q: What is the molecular weight of Hexanitrobenzene? |
| A: Molecular weight of Hexanitrobenzene is 348.09700. |
| Q: What is the Chinese name of 13232-74-1? |
| A: Chinese name of 13232-74-1 is 13232-74-1. |
| Q: What is the LogP of Hexanitrobenzene? |
| A: LogP of Hexanitrobenzene is 4.27500. |
| Q: What is the polar surface area (PSA) of Hexanitrobenzene? |
| A: Polar surface area (PSA) of Hexanitrobenzene is 274.92000. |
| Q: What is the InChIKey of Hexanitrobenzene? |
| A: InChIKey of Hexanitrobenzene is BVKZIAODKDJPLW-UHFFFAOYSA-N. |