N,N-dimethyl-9-[(4-nitrophenyl)methyl]purin-6-amine structure
|
Common Name | N,N-dimethyl-9-[(4-nitrophenyl)methyl]purin-6-amine | ||
|---|---|---|---|---|
| CAS Number | 13233-85-7 | Molecular Weight | 298.30000 | |
| Density | 1.4g/cm3 | Boiling Point | 542.9ºC at 760 mmHg | |
| Molecular Formula | C14H14N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.2ºC | |
| Name | N,N-dimethyl-9-[(4-nitrophenyl)methyl]purin-6-amine |
|---|
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 542.9ºC at 760 mmHg |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.30000 |
| Flash Point | 282.2ºC |
| Exact Mass | 298.11800 |
| PSA | 92.66000 |
| LogP | 2.37200 |
| Vapour Pressure | 7.52E-12mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | JVMODBRXTBWHGI-UHFFFAOYSA-N |
| SMILES | CN(C)c1ncnc2c1ncn2Cc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |