methyl 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate
Modify Date: 2025-09-25 18:35:46
methyl 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate structure
|
Common Name | methyl 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate | ||
|---|---|---|---|---|
| CAS Number | 132424-36-3 | Molecular Weight | 306.12600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7F9O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7F9O2 |
|---|---|
| Molecular Weight | 306.12600 |
| Exact Mass | 306.03000 |
| PSA | 26.30000 |
| LogP | 3.40780 |
| InChIKey | XNPUIKGMNMTLOL-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| Methyl 2H,2H,3H,3H-perfluoroheptanoate |