Methyl 3-chloro-4,5-dihydroxybenzoate structure
|
Common Name | Methyl 3-chloro-4,5-dihydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 132496-77-6 | Molecular Weight | 202.59200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-chloro-4,5-dihydroxybenzoate |
|---|
| Molecular Formula | C8H7ClO4 |
|---|---|
| Molecular Weight | 202.59200 |
| Exact Mass | 202.00300 |
| PSA | 66.76000 |
| LogP | 1.53780 |
| InChIKey | SWRZROKGZUCAQN-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(O)c(O)c(Cl)c1 |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |