Rubrofusarin structure
|
Common Name | Rubrofusarin | ||
|---|---|---|---|---|
| CAS Number | 13252-22-7 | Molecular Weight | 284.31300 | |
| Density | 1.358g/cm3 | Boiling Point | 469.7ºC at 760 mmHg | |
| Molecular Formula | C15H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.9ºC | |
| Name | [4-[[4-(carbamoylamino)phenyl]methyl]phenyl]urea |
|---|
| Density | 1.358g/cm3 |
|---|---|
| Boiling Point | 469.7ºC at 760 mmHg |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.31300 |
| Flash Point | 237.9ºC |
| Exact Mass | 284.12700 |
| PSA | 110.24000 |
| LogP | 3.80520 |
| Vapour Pressure | 5.38E-09mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | LMFOYEUWVQZEAW-UHFFFAOYSA-N |
| SMILES | NC(=O)Nc1ccc(Cc2ccc(NC(N)=O)cc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |