6-(4-Methylpiperazin-1-yl)nicotinic acid structure
|
Common Name | 6-(4-Methylpiperazin-1-yl)nicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 132521-70-1 | Molecular Weight | 221.25600 | |
| Density | 1.239g/cm3 | Boiling Point | 420.197ºC at 760 mmHg | |
| Molecular Formula | C11H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.928ºC | |
| Name | 6-(4-methylpiperazin-1-yl)pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.239g/cm3 |
|---|---|
| Boiling Point | 420.197ºC at 760 mmHg |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.25600 |
| Flash Point | 207.928ºC |
| Exact Mass | 221.11600 |
| PSA | 56.67000 |
| LogP | 0.53450 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | QHMVJHRGUIQPPU-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2ccc(C(=O)O)cn2)CC1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-(4-Methyl-1-piperazinyl)nicotinic acid |
| 6-(4-methyl-1-piperazinyl)-3-pyridinecarboxylic acid |
| 3-Pyridinecarboxylicacid,6-(4-methyl-1-piperazinyl) |
| 6-(4-Methylpiperazin-1-yl)nicotinic acid |