25-Hydroxyvitamin D2 (25,26,27-13C3)
Modify Date: 2026-07-07 19:30:52
25-Hydroxyvitamin D2 (25,26,27-13C3) structure
|
Common Name | 25-Hydroxyvitamin D2 (25,26,27-13C3) | ||
|---|---|---|---|---|
| CAS Number | 1325307-59-2 | Molecular Weight | 415.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H44O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 25-Hydroxyvitamin D2 (25,26,27-13C3) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C28H44O2 |
|---|---|
| Molecular Weight | 415.6 |
| InChIKey | KJKIIUAXZGLUND-RQYUKPBQSA-N |
| SMILES | C=C1CCC(O)CC1=CC=C1CCCC2(C)C1CCC2C(C)C=CC(C)C(C)(C)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 25-Hydroxyvitamin D2 (25,26,27-13C3)? |
| A: SMILES notation of 25-Hydroxyvitamin D2 (25,26,27-13C3) is C=C1CCC(O)CC1=CC=C1CCCC2(C)C1CCC2C(C)C=CC(C)C(C)(C)O. |
| Q: What is the InChIKey of 25-Hydroxyvitamin D2 (25,26,27-13C3)? |
| A: InChIKey of 25-Hydroxyvitamin D2 (25,26,27-13C3) is KJKIIUAXZGLUND-RQYUKPBQSA-N. |
| Q: What is the English name of 25-Hydroxyvitamin D2 (25,26,27-13C3)? |
| A: The English name of 25-Hydroxyvitamin D2 (25,26,27-13C3) is 25-Hydroxyvitamin D2 (25,26,27-13C3). |
| Q: What is the molecular formula of 25-Hydroxyvitamin D2 (25,26,27-13C3)? |
| A: Molecular formula of 25-Hydroxyvitamin D2 (25,26,27-13C3) is C28H44O2. |
| Q: What is the CAS number of 25-Hydroxyvitamin D2 (25,26,27-13C3)? |
| A: CAS number of 25-Hydroxyvitamin D2 (25,26,27-13C3) is 1325307-59-2. |
| Q: What is the molecular weight of 25-Hydroxyvitamin D2 (25,26,27-13C3)? |
| A: Molecular weight of 25-Hydroxyvitamin D2 (25,26,27-13C3) is 415.6. |
| Q: What is the Chinese name of 1325307-59-2? |
| A: Chinese name of 1325307-59-2 is 1325307-59-2. |