3-Chloro-4,5,6-triphenylpyridazine
Modify Date: 2025-10-23 19:42:19
3-Chloro-4,5,6-triphenylpyridazine structure
|
Common Name | 3-Chloro-4,5,6-triphenylpyridazine | ||
|---|---|---|---|---|
| CAS Number | 132575-64-5 | Molecular Weight | 342.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H15ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Chloro-4,5,6-triphenylpyridazine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H15ClN2 |
|---|---|
| Molecular Weight | 342.8 |
| InChIKey | OJQIWDHKTMIESL-UHFFFAOYSA-N |
| SMILES | Clc1nnc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-Chloro-4,5,6-triphenylpyridazine? |
| A: CAS number of 3-Chloro-4,5,6-triphenylpyridazine is 132575-64-5. |
| Q: What is the Chinese name of 132575-64-5? |
| A: Chinese name of 132575-64-5 is 132575-64-5. |
| Q: What is the molecular formula of 3-Chloro-4,5,6-triphenylpyridazine? |
| A: Molecular formula of 3-Chloro-4,5,6-triphenylpyridazine is C22H15ClN2. |
| Q: What is the SMILES notation of 3-Chloro-4,5,6-triphenylpyridazine? |
| A: SMILES notation of 3-Chloro-4,5,6-triphenylpyridazine is Clc1nnc(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1. |
| Q: What is the molecular weight of 3-Chloro-4,5,6-triphenylpyridazine? |
| A: Molecular weight of 3-Chloro-4,5,6-triphenylpyridazine is 342.8. |
| Q: What is the InChIKey of 3-Chloro-4,5,6-triphenylpyridazine? |
| A: InChIKey of 3-Chloro-4,5,6-triphenylpyridazine is OJQIWDHKTMIESL-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Chloro-4,5,6-triphenylpyridazine? |
| A: The English name of 3-Chloro-4,5,6-triphenylpyridazine is 3-Chloro-4,5,6-triphenylpyridazine. |