4-(2,5-DIOXO-4-PHENYL-3,4,5,6,7,8-HEXAHYDRO-2H-QUINOLIN-1-YL)-BENZOIC ACID structure
|
Common Name | 4-(2,5-DIOXO-4-PHENYL-3,4,5,6,7,8-HEXAHYDRO-2H-QUINOLIN-1-YL)-BENZOIC ACID | ||
|---|---|---|---|---|
| CAS Number | 132600-15-8 | Molecular Weight | 361.39100 | |
| Density | 1.37g/cm3 | Boiling Point | 620.1ºC at 760 mmHg | |
| Molecular Formula | C22H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.8ºC | |
| Name | 4-(2,5-dioxo-4-phenyl-4,6,7,8-tetrahydro-3H-quinolin-1-yl)benzoic acid |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 620.1ºC at 760 mmHg |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.39100 |
| Flash Point | 328.8ºC |
| Exact Mass | 361.13100 |
| PSA | 74.68000 |
| LogP | 3.97740 |
| Vapour Pressure | 3.1E-16mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | YKOQJZBGSAHKQO-UHFFFAOYSA-N |
| SMILES | O=C1CCCC2=C1C(c1ccccc1)CC(=O)N2c1ccc(C(=O)O)cc1 |
| HS Code | 2933499090 |
|---|
|
~62%
4-(2,5-DIOXO-4-... CAS#:132600-15-8 |
| Literature: Strozhev, M. F.; Lielbriedis, I. E. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1990 , vol. 26, # 7 p. 790 - 792 Khimiya Geterotsiklicheskikh Soedinenii, 1990 , # 7 p. 947 - 949 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |