Urea,N-[1,1'-biphenyl]-4-yl- structure
|
Common Name | Urea,N-[1,1'-biphenyl]-4-yl- | ||
|---|---|---|---|---|
| CAS Number | 13262-48-1 | Molecular Weight | 212.24700 | |
| Density | 1.213g/cm3 | Boiling Point | 366.9ºC at 760mmHg | |
| Molecular Formula | C13H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.7ºC | |
| Name | (4-phenylphenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 366.9ºC at 760mmHg |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.24700 |
| Flash Point | 175.7ºC |
| Exact Mass | 212.09500 |
| PSA | 55.12000 |
| LogP | 3.61750 |
| Vapour Pressure | 1.42E-05mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | FAVOSJNIJZMFAB-UHFFFAOYSA-N |
| SMILES | NC(=O)Nc1ccc(-c2ccccc2)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| amino-N-(4-phenylphenyl)amide |
| 1-biphenyl-4-ylurea |
| N-(4-biphenylyl)urea |
| 4-[1,1'-biphenyl]ylurea |
| p-Phenyl-phenylharnstoff |
| Biphenyl-4-yl-harnstoff |
| n-(1,1'-biphenyl-4-yl)urea |
| Biphenyl-4-ylurea |
| 4-phenyl-phenyl urea |