methyl (2S)-2-amino-3-(4-hydroxy-3-methylphenyl)-2-methylpropanoate,hydrochloride structure
|
Common Name | methyl (2S)-2-amino-3-(4-hydroxy-3-methylphenyl)-2-methylpropanoate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 13265-01-5 | Molecular Weight | 259.72900 | |
| Density | N/A | Boiling Point | 346ºC at 760 mmHg | |
| Molecular Formula | C12H18ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163ºC | |
| Name | methyl (2S)-2-amino-3-(4-hydroxy-3-methylphenyl)-2-methylpropanoate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 346ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.72900 |
| Flash Point | 163ºC |
| Exact Mass | 259.09800 |
| PSA | 72.55000 |
| LogP | 2.63580 |
| Vapour Pressure | 2.97E-05mmHg at 25°C |
| InChIKey | ZWBVPAVQVBYURF-YDALLXLXSA-N |
| SMILES | COC(=O)C(C)(N)Cc1ccc(O)c(C)c1.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| h 59/64 |