2-[(2-Propylvaleryl)oxy]benzoic acid structure
|
Common Name | 2-[(2-Propylvaleryl)oxy]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 13265-02-6 | Molecular Weight | 264.31700 | |
| Density | 1.105g/cm3 | Boiling Point | 390.9ºC at 760 mmHg | |
| Molecular Formula | C15H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.5ºC | |
| Name | 2-(2-propylpentanoyloxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.105g/cm3 |
|---|---|
| Boiling Point | 390.9ºC at 760 mmHg |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.31700 |
| Flash Point | 139.5ºC |
| Exact Mass | 264.13600 |
| PSA | 63.60000 |
| LogP | 3.50660 |
| Vapour Pressure | 8.22E-07mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | HILHGPGUHSJXAX-UHFFFAOYSA-N |
| SMILES | CCCC(CCC)C(=O)Oc1ccccc1C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Acide dipropylacetyl salicylique |
| Pentanoic acid,2-propyl-,2-carboxyphenyl ester |
| Salicylic acid,2-propylvalerate |