2,7-Dibromo-9-phenyl-9H-fluoren-9-ol structure
|
Common Name | 2,7-Dibromo-9-phenyl-9H-fluoren-9-ol | ||
|---|---|---|---|---|
| CAS Number | 132717-37-4 | Molecular Weight | 416.106 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 526.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H12Br2O | Melting Point | 165 °C | |
| MSDS | N/A | Flash Point | 272.1±30.1 °C | |
| Name | 2,7-dibromo-9-phenylfluoren-9-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 526.4±50.0 °C at 760 mmHg |
| Melting Point | 165 °C |
| Molecular Formula | C19H12Br2O |
| Molecular Weight | 416.106 |
| Flash Point | 272.1±30.1 °C |
| Exact Mass | 413.925476 |
| PSA | 20.23000 |
| LogP | 5.38 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.722 |
| InChIKey | VGZUBRZNTWOSTO-UHFFFAOYSA-N |
| SMILES | OC1(c2ccccc2)c2cc(Br)ccc2-c2ccc(Br)cc21 |
|
~77%
2,7-Dibromo-9-p... CAS#:132717-37-4 |
| Literature: Zhuang, Xiaodong; Zhang, Yi; Cao, Chengan; Zhang, Fan; Wu, Dongqing; Feng, Xinliang Science China Chemistry, 2013 , vol. 56, # 8 p. 1112 - 1118 |
|
~%
2,7-Dibromo-9-p... CAS#:132717-37-4 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , # 12 p. 2167 - 2177 |
|
~%
2,7-Dibromo-9-p... CAS#:132717-37-4 |
| Literature: Macromolecules, , vol. 43, # 24 p. 10355 - 10365 |
|
~%
2,7-Dibromo-9-p... CAS#:132717-37-4 |
| Literature: US6162824 A1, ; |
| 2,7-dibromo-9-phenyl-9-fluorenol |
| 2,7-dibromo-9-phenyl-fluoren-9-ol |
| 9H-Fluoren-9-ol, 2,7-dibromo-9-phenyl- |
| 2,7-dibromo-(9-phenyl-9H-fluoren-9-ol) |
| 2,7-Dibromo-9-phenyl-9H-fluoren-9-ol |
| 2,5-DIMETHYL-7-THIA-2,5-DIAZABICYCLO[2.2.1]HEPTANES-3,6-DIONE |
| AC-5815 |