1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea
Modify Date: 2025-09-09 17:52:23
1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea structure
|
Common Name | 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea | ||
|---|---|---|---|---|
| CAS Number | 1327654-50-1 | Molecular Weight | 257.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13BrN2O |
|---|---|
| Molecular Weight | 257.13 |
| InChIKey | QMRUDAIFRDQURO-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)cc(NC(=O)N(C)C)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea? |
| A: SMILES notation of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea is Cc1cc(Br)cc(NC(=O)N(C)C)c1. |
| Q: What is the molecular formula of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea? |
| A: Molecular formula of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea is C10H13BrN2O. |
| Q: What is the molecular weight of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea? |
| A: Molecular weight of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea is 257.13. |
| Q: What is the InChIKey of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea? |
| A: InChIKey of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea is QMRUDAIFRDQURO-UHFFFAOYSA-N. |
| Q: What is the English name of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea? |
| A: The English name of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea is 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea. |
| Q: What is the Chinese name of 1327654-50-1? |
| A: Chinese name of 1327654-50-1 is 1327654-50-1. |
| Q: What is the CAS number of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea? |
| A: CAS number of 1-(3-Bromo-5-methylphenyl)-3,3-dimethylurea is 1327654-50-1. |