diethyl 2-[(2,2-dichloroacetyl)-phenyl-amino]propanedioate structure
|
Common Name | diethyl 2-[(2,2-dichloroacetyl)-phenyl-amino]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 13277-53-7 | Molecular Weight | 362.20500 | |
| Density | 1.338g/cm3 | Boiling Point | 433.3ºC at 760 mmHg | |
| Molecular Formula | C15H17Cl2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.9ºC | |
| Name | diethyl 2-(N-(2,2-dichloroacetyl)anilino)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 433.3ºC at 760 mmHg |
| Molecular Formula | C15H17Cl2NO5 |
| Molecular Weight | 362.20500 |
| Flash Point | 215.9ºC |
| Exact Mass | 361.04800 |
| PSA | 72.91000 |
| LogP | 2.31810 |
| Vapour Pressure | 1.03E-07mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | LIMCZYYAMCUZMD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)N(C(=O)C(Cl)Cl)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Dichloracetanilidomalonsaeurediaethylester |
| Diethyl-N-phenyl-dichloracetamid-malonat |