6-Ethylthioinosine structure
|
Common Name | 6-Ethylthioinosine | ||
|---|---|---|---|---|
| CAS Number | 13286-04-9 | Molecular Weight | 312.34500 | |
| Density | 1.76g/cm3 | Boiling Point | 632.4ºC at 760 mmHg | |
| Molecular Formula | C12H16N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.3ºC | |
Use of 6-Ethylthioinosine6-Ethylthioinosine (6-ETI. |
| Name | 6-Ethylthioinosine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 632.4ºC at 760 mmHg |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.34500 |
| Flash Point | 336.3ºC |
| Exact Mass | 312.08900 |
| PSA | 138.82000 |
| Vapour Pressure | 7.32E-17mmHg at 25°C |
| Index of Refraction | 1.787 |
| InChIKey | SXDRPWJMWHDCLL-WOUKDFQISA-N |
| SMILES | CCSc1ncnc2c1ncn2C1OC(CO)C(O)C1O |
| 5-acetyl-4,7-dimethoxy-6-ethoxybenzofuran |
| 6-Ethylmercaptopurine riboside |
| 6-Ethylmercaptopurinribonucleosid |