N-[(2-methyl-1-phenyl-propylidene)amino]-2,4-dinitro-aniline structure
|
Common Name | N-[(2-methyl-1-phenyl-propylidene)amino]-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 13289-16-2 | Molecular Weight | 328.32300 | |
| Density | 1.3g/cm3 | Boiling Point | 469.8ºC at 760 mmHg | |
| Molecular Formula | C16H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.9ºC | |
| Name | N-[(2-methyl-1-phenylpropylidene)amino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 469.8ºC at 760 mmHg |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.32300 |
| Flash Point | 237.9ºC |
| Exact Mass | 328.11700 |
| PSA | 116.03000 |
| LogP | 5.09460 |
| Vapour Pressure | 5.34E-09mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | BBWHJPVNVNUGOQ-UHFFFAOYSA-N |
| SMILES | CC(C)C(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])c1ccccc1 |
|
~%
N-[(2-methyl-1-... CAS#:13289-16-2 |
| Literature: Evans Journal of the Chemical Society, 1936 , p. 785,788 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| isobutyrophenone-(2,4-dinitro-phenylhydrazone) |
| 2,5-dimethyl-4-hydroxyhexan-3-one |
| 4-Hydroxy-2,5-dimethyl-3-hexanone |
| SMYRRYXXNJLYLY-UHFFFAOYSA |
| 2.4-Dinitro-phenylhydrazon des Isopropyl-phenyl-ketons |
| Isobutyrophenon-<2.4-dinitro-phenylhydrazon> |
| Isopropyl-isobutyryl-carbinol |
| 2,5-Dimethyl-4-hydroxy-3-hexanone |
| Isopropylphenylketon-2,4-dinitrophenylhydrazon |
| 4-hydroxy-2,5-dimethyl-hexan-3-one |
| 4-Hydroxy-2,5-dimethyl-hexan-3-on |
| isobutyroin |