3-[(4-methoxyphenyl)methylidene]-5-phenyl-furan-2-one structure
|
Common Name | 3-[(4-methoxyphenyl)methylidene]-5-phenyl-furan-2-one | ||
|---|---|---|---|---|
| CAS Number | 13294-96-7 | Molecular Weight | 278.30200 | |
| Density | 1.245g/cm3 | Boiling Point | 517.9ºC at 760 mmHg | |
| Molecular Formula | C18H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.8ºC | |
| Name | 3-[(4-methoxyphenyl)methylidene]-5-phenylfuran-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 517.9ºC at 760 mmHg |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.30200 |
| Flash Point | 224.8ºC |
| Exact Mass | 278.09400 |
| PSA | 35.53000 |
| LogP | 3.67650 |
| Vapour Pressure | 7.84E-11mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | HQLTUKXUNPCMBT-PTNGSMBKSA-N |
| SMILES | COc1ccc(C=C2C=C(c3ccccc3)OC2=O)cc1 |
|
~78%
3-[(4-methoxyph... CAS#:13294-96-7 |
| Literature: Reddy, G. Sudhakar; Mohan, G. Hari; Iyengar, D. S. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1998 , vol. 37, # 11 p. 1167 - 1168 |
|
~%
3-[(4-methoxyph... CAS#:13294-96-7 |
| Literature: Borsche Chemische Berichte, 1914 , vol. 47, p. 1113 |
|
~%
3-[(4-methoxyph... CAS#:13294-96-7 |
| Literature: Khattab, Samir A.; Hosny, Mohammad M. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 12 p. 1038 - 1043 |
| 3-(4-methoxy-benzylidene)-5-phenyl-3H-furan-2-one |
| 3-p-Methoxybenzyliden-5-phenyl-furan-2(3H)-on |
| 3-(4-Methoxy-benzyliden)-5-phenyl-3H-furan-2-on |
| 3-(4-dimethylamino-benzylidene)-5-phenyl-3H-furan-2-one |
| 2-Oxo-3-<4-methoxy-benzyliden>-5-phenyl-2.3-dihydrofuran |
| 3-p-Dimethylaminobenzyliden-5-phenylfuran-2(3H)-on |
| 4-Hydroxy-2-(4-methoxybenzyliden)-4-phenyl-but-3-ensaeurelacton |
| 5-Phenyl-3-<4-dimethylamino-benzyliden>-2,3-dihydro-furanon-(2) |