MTS-TAMRA structure
|
Common Name | MTS-TAMRA | ||
|---|---|---|---|---|
| CAS Number | 1329837-19-5 | Molecular Weight | 567.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H29N3O6S2 | Melting Point | 286-191° C (lit.)(dec.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | MTS-TAMRA |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 286-191° C (lit.)(dec.) |
|---|---|
| Molecular Formula | C28H29N3O6S2 |
| Molecular Weight | 567.68 |
| Exact Mass | 583.181091 |
| InChIKey | XRWWYYMLHIPCSG-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCSS(C)(=O)=O.CN(C)c1ccc2c(c1)Oc1cc(N(C)C)ccc1C21OC(=O)c2ccccc21 |
| Water Solubility | Soluble in Dimethylformamide and Dimethyl Sulfoxide |
| S-(2-Acetamidoethyl) methanesulfonothioate - 3',6'-bis(dimethylamino)-3H-spiro[2-benzofuran-1,9'-xanthen]-3-one (1:1) |
| Methanesulfonothioic acid, S-[2-(acetylamino)ethyl] ester, compd. with 3',6'-bis(dimethylamino)spiro[isobenzofuran-1(3H),9'-[9H]xanthen]-3-one (1:1) |
| MTS-TAMRA is known as a Sulfhydryl-active fluorescent reagent. |