7H-Furo3,2-g1benzopyran-7-one, 3-methoxy-2-(1-methylethyl)- structure
|
Common Name | 7H-Furo3,2-g1benzopyran-7-one, 3-methoxy-2-(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 133-26-6 | Molecular Weight | 258.26900 | |
| Density | 1.241g/cm3 | Boiling Point | 422.9ºC at 760mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.6ºC | |
| Name | peucedanin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.241g/cm3 |
|---|---|
| Boiling Point | 422.9ºC at 760mmHg |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.26900 |
| Flash Point | 209.6ºC |
| Exact Mass | 258.08900 |
| PSA | 52.58000 |
| LogP | 3.67120 |
| Vapour Pressure | 2.32E-07mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | YQBNJPACAUPNLV-UHFFFAOYSA-N |
| SMILES | COc1c(C(C)C)oc2cc3oc(=O)ccc3cc12 |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Peucedanin |
| Oreoselone methyl ether |
| Peutsedin |
| 3-methoxy-2-propan-2-ylfuro[3,2-g]chromen-7-one |