2-tert-butyl-6-[(3-tert-butyl-2-hydroxyphenyl)methyl]phenol structure
|
Common Name | 2-tert-butyl-6-[(3-tert-butyl-2-hydroxyphenyl)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 133-63-1 | Molecular Weight | 312.44600 | |
| Density | 1.044g/cm3 | Boiling Point | 408.1ºC at 760mmHg | |
| Molecular Formula | C21H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.5ºC | |
| Name | 2-tert-butyl-6-[(3-tert-butyl-2-hydroxyphenyl)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.044g/cm3 |
|---|---|
| Boiling Point | 408.1ºC at 760mmHg |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.44600 |
| Flash Point | 176.5ºC |
| Exact Mass | 312.20900 |
| PSA | 40.46000 |
| LogP | 5.28360 |
| Vapour Pressure | 3.04E-07mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | PHAZIZJZLYBIIT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cccc(Cc2cccc(C(C)(C)C)c2O)c1O |
| HS Code | 2907299090 |
|---|
|
~90%
2-tert-butyl-6-... CAS#:133-63-1 |
| Literature: Casiraghi, Giovanni; Casnati, Giuseppe; Pochini, Andrea; Puglia, Giuseppe; Ungaro, Rocco; Sartori, Giovanni Synthesis, 1981 , # 2 p. 143 - 146 |
|
~21%
2-tert-butyl-6-... CAS#:133-63-1 |
| Literature: Davis; Balsells; Carroll; Walsh Organic letters, 2001 , vol. 3, # 14 p. 2161 - 2164 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| EINECS 205-115-1 |
| 2,2'-dihydroxy-3,3'-di-tert-butyldiphenylmethane |
| Bis-<2-hydroxy-3-tert.butyl-phenyl)-methan |