Bis(6-methylheptyl) 2-butenedioate structure
|
Common Name | Bis(6-methylheptyl) 2-butenedioate | ||
|---|---|---|---|---|
| CAS Number | 1330-75-2 | Molecular Weight | 340.497 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 409.8±18.0 °C at 760 mmHg | |
| Molecular Formula | C4H2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.4±19.6 °C | |
| Name | Isooctyl alcohol*, fumarate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.8±18.0 °C at 760 mmHg |
| Molecular Formula | C4H2O4 |
| Molecular Weight | 340.497 |
| Flash Point | 190.4±19.6 °C |
| Exact Mass | 340.261353 |
| PSA | 52.60000 |
| LogP | 7.69 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | QIGLLCHDIZAZFE-BUHFOSPRSA-N |
| SMILES | CC(C)CCCCCOC(=O)C=CC(=O)OCCCCCC(C)C |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Butenedioic acid, bis(6-methylheptyl) ester |
| Bis(6-methylheptyl) 2-butenedioate |
| diisooctyl fumarate |